C20H34N4O6S — CID 118913925
(6R)-1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxylic acid (PubChem CID 118913925) has the molecular formula C20H34N4O6S and a molecular weight of 458.58 g/mol. Its IUPAC name is (6R)-1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxylic acid.
| Compound Name | (6R)-1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxylic acid |
|---|---|
| PubChem CID | 118913925 |
| Molecular Formula | C20H34N4O6S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | (6R)-1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxylic acid |
| SMILES | CNC(C)C(=O)NC(C(=O)N1CCC2C1[C@H](C(=O)O)CN2S(C)(=O)=O)C1CCCCC1 |
| InChI | InChI=1S/C20H34N4O6S/c1-12(21-2)18(25)22-16(13-7-5-4-6-8-13)19(26)23-10-9-15-17(23)14(20(27)28)11-24(15)31(3,29)30/h12-17,21H,4-11H2,1-3H3,(H,22,25)(H,27,28)/t12?,14-,15?,16?,17?/m1/s1 |
| InChIKey | OFXKEFPSUIECNF-LROQKECFSA-N |
| XLogP | -0.40 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |