C26H38FN5O4 — CID 67606944
1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-6-(4-fluorophenoxy)-N-methyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide (PubChem CID 67606944) has the molecular formula C26H38FN5O4 and a molecular weight of 503.62 g/mol. Its IUPAC name is 1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-6-(4-fluorophenoxy)-N-methyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide.
| Compound Name | 1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-6-(4-fluorophenoxy)-N-methyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 67606944 |
| Molecular Formula | C26H38FN5O4 |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | 1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-6-(4-fluorophenoxy)-N-methyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide |
| SMILES | CNC(=O)N1CC(Oc2ccc(F)cc2)C2C1CCN2C(=O)C(NC(=O)C(C)NC)C1CCCCC1 |
| InChI | InChI=1S/C26H38FN5O4/c1-16(28-2)24(33)30-22(17-7-5-4-6-8-17)25(34)31-14-13-20-23(31)21(15-32(20)26(35)29-3)36-19-11-9-18(27)10-12-19/h9-12,16-17,20-23,28H,4-8,13-15H2,1-3H3,(H,29,35)(H,30,33) |
| InChIKey | MDJNNVQIYYHOBX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |