C25H38N4O3 — CID 75288174
N-[1-cyclohexyl-2-oxo-2-(6-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)ethyl]-2-(methylamino)propanamide (PubChem CID 75288174) has the molecular formula C25H38N4O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is N-[1-cyclohexyl-2-oxo-2-(6-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)ethyl]-2-(methylamino)propanamide.
| Compound Name | N-[1-cyclohexyl-2-oxo-2-(6-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)ethyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 75288174 |
| Molecular Formula | C25H38N4O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | N-[1-cyclohexyl-2-oxo-2-(6-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)ethyl]-2-(methylamino)propanamide |
| SMILES | CNC(C)C(=O)NC(C(=O)N1CCC2NCC(OCc3ccccc3)C21)C1CCCCC1 |
| InChI | InChI=1S/C25H38N4O3/c1-17(26-2)24(30)28-22(19-11-7-4-8-12-19)25(31)29-14-13-20-23(29)21(15-27-20)32-16-18-9-5-3-6-10-18/h3,5-6,9-10,17,19-23,26-27H,4,7-8,11-16H2,1-2H3,(H,28,30) |
| InChIKey | ITLCSWKKYRTNLF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |