C28H39FN4O4S — CID 58446132
(2R)-N-[(1S)-2-[(3aR,6R,6aR)-6-(6-fluoro-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-methylbutanamide (PubChem CID 58446132) has the molecular formula C28H39FN4O4S and a molecular weight of 546.71 g/mol. Its IUPAC name is (2R)-N-[(1S)-2-[(3aR,6R,6aR)-6-(6-fluoro-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-methylbutanamide.
| Compound Name | (2R)-N-[(1S)-2-[(3aR,6R,6aR)-6-(6-fluoro-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 58446132 |
| Molecular Formula | C28H39FN4O4S |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | (2R)-N-[(1S)-2-[(3aR,6R,6aR)-6-(6-fluoro-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-methylbutanamide |
| SMILES | CC[C@@H](C)C(=O)N[C@H](C(=O)N1CC[C@@H]2[C@H]1[C@H](c1c[nH]c3cc(F)ccc13)CN2S(C)(=O)=O)C1CCCCC1 |
| InChI | InChI=1S/C28H39FN4O4S/c1-4-17(2)27(34)31-25(18-8-6-5-7-9-18)28(35)32-13-12-24-26(32)22(16-33(24)38(3,36)37)21-15-30-23-14-19(29)10-11-20(21)23/h10-11,14-15,17-18,22,24-26,30H,4-9,12-13,16H2,1-3H3,(H,31,34)/t17-,22+,24-,25+,26-/m1/s1 |
| InChIKey | ZMYDIBVFHZIWKM-SUYWHSBXSA-N |
| XLogP | 3.75 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |