C29H42N4O2 — CID 58446317
(2R)-N-[(2S)-1-[(3aR,6S,6aR)-4-cyclopentyl-6-(6-methyl-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-oxobutan-2-yl]-2-methylbutanamide (PubChem CID 58446317) has the molecular formula C29H42N4O2 and a molecular weight of 478.68 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-[(3aR,6S,6aR)-4-cyclopentyl-6-(6-methyl-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-oxobutan-2-yl]-2-methylbutanamide.
| Compound Name | (2R)-N-[(2S)-1-[(3aR,6S,6aR)-4-cyclopentyl-6-(6-methyl-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-oxobutan-2-yl]-2-methylbutanamide |
|---|---|
| PubChem CID | 58446317 |
| Molecular Formula | C29H42N4O2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | (2R)-N-[(2S)-1-[(3aR,6S,6aR)-4-cyclopentyl-6-(6-methyl-1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-oxobutan-2-yl]-2-methylbutanamide |
| SMILES | CC[C@@H](C)C(=O)N[C@@H](CC)C(=O)N1CC[C@@H]2[C@H]1[C@@H](c1c[nH]c3cc(C)ccc13)CN2C1CCCC1 |
| InChI | InChI=1S/C29H42N4O2/c1-5-19(4)28(34)31-24(6-2)29(35)32-14-13-26-27(32)23(17-33(26)20-9-7-8-10-20)22-16-30-25-15-18(3)11-12-21(22)25/h11-12,15-16,19-20,23-24,26-27,30H,5-10,13-14,17H2,1-4H3,(H,31,34)/t19-,23-,24+,26-,27-/m1/s1 |
| InChIKey | COLYALNJTQEFMK-YNGZFJNUSA-N |
| XLogP | 4.73 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |