C25H36N4O4S — CID 58446289
(2R)-N-[(2S)-1-[(3aR,6S,6aR)-6-(6-methyl-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-oxobutan-2-yl]-2-methylbutanamide (PubChem CID 58446289) has the molecular formula C25H36N4O4S and a molecular weight of 488.65 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-[(3aR,6S,6aR)-6-(6-methyl-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-oxobutan-2-yl]-2-methylbutanamide.
| Compound Name | (2R)-N-[(2S)-1-[(3aR,6S,6aR)-6-(6-methyl-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-oxobutan-2-yl]-2-methylbutanamide |
|---|---|
| PubChem CID | 58446289 |
| Molecular Formula | C25H36N4O4S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | (2R)-N-[(2S)-1-[(3aR,6S,6aR)-6-(6-methyl-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-oxobutan-2-yl]-2-methylbutanamide |
| SMILES | CC[C@@H](C)C(=O)N[C@@H](CC)C(=O)N1CC[C@@H]2[C@H]1[C@@H](c1c[nH]c3cc(C)ccc13)CN2S(C)(=O)=O |
| InChI | InChI=1S/C25H36N4O4S/c1-6-16(4)24(30)27-20(7-2)25(31)28-11-10-22-23(28)19(14-29(22)34(5,32)33)18-13-26-21-12-15(3)8-9-17(18)21/h8-9,12-13,16,19-20,22-23,26H,6-7,10-11,14H2,1-5H3,(H,27,30)/t16-,19-,20+,22-,23-/m1/s1 |
| InChIKey | OAHKELGXAJTCEG-IHWDNLPISA-N |
| XLogP | 2.75 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |