C28H39FN4O5S — CID 67412114
tert-butyl N-[1-cyclohexyl-2-[6-(6-fluoro-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-2-oxoethyl]carbamate (PubChem CID 67412114) has the molecular formula C28H39FN4O5S and a molecular weight of 562.71 g/mol. Its IUPAC name is tert-butyl N-[1-cyclohexyl-2-[6-(6-fluoro-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[1-cyclohexyl-2-[6-(6-fluoro-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 67412114 |
| Molecular Formula | C28H39FN4O5S |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | tert-butyl N-[1-cyclohexyl-2-[6-(6-fluoro-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)N1CCC2C1C(c1c[nH]c3cc(F)ccc13)CN2S(C)(=O)=O)C1CCCCC1 |
| InChI | InChI=1S/C28H39FN4O5S/c1-28(2,3)38-27(35)31-24(17-8-6-5-7-9-17)26(34)32-13-12-23-25(32)21(16-33(23)39(4,36)37)20-15-30-22-14-18(29)10-11-19(20)22/h10-11,14-15,17,21,23-25,30H,5-9,12-13,16H2,1-4H3,(H,31,35) |
| InChIKey | JMSOJSDHORULIM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |