C24H33FN4O5S — CID 143960701
tert-butyl N-[1-[(3aR,6aR)-6-(6-fluoro-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-oxobutan-2-yl]carbamate (PubChem CID 143960701) has the molecular formula C24H33FN4O5S and a molecular weight of 508.62 g/mol. Its IUPAC name is tert-butyl N-[1-[(3aR,6aR)-6-(6-fluoro-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(3aR,6aR)-6-(6-fluoro-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 143960701 |
| Molecular Formula | C24H33FN4O5S |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | tert-butyl N-[1-[(3aR,6aR)-6-(6-fluoro-1H-indol-3-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-oxobutan-2-yl]carbamate |
| SMILES | CCC(NC(=O)OC(C)(C)C)C(=O)N1CC[C@@H]2[C@H]1C(c1c[nH]c3cc(F)ccc13)CN2S(C)(=O)=O |
| InChI | InChI=1S/C24H33FN4O5S/c1-6-18(27-23(31)34-24(2,3)4)22(30)28-10-9-20-21(28)17(13-29(20)35(5,32)33)16-12-26-19-11-14(25)7-8-15(16)19/h7-8,11-12,17-18,20-21,26H,6,9-10,13H2,1-5H3,(H,27,31)/t17?,18?,20-,21-/m1/s1 |
| InChIKey | SXGWIWNFXIEEMQ-OWQMCBFZSA-N |
| XLogP | 2.94 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |