C29H36FN5O3 — CID 75095741
2-amino-N-[1-[6-(1-benzyl-6-fluoroindol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-methoxy-1-oxobutan-2-yl]propanamide (PubChem CID 75095741) has the molecular formula C29H36FN5O3 and a molecular weight of 521.64 g/mol. Its IUPAC name is 2-amino-N-[1-[6-(1-benzyl-6-fluoroindol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-methoxy-1-oxobutan-2-yl]propanamide.
| Compound Name | 2-amino-N-[1-[6-(1-benzyl-6-fluoroindol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-methoxy-1-oxobutan-2-yl]propanamide |
|---|---|
| PubChem CID | 75095741 |
| Molecular Formula | C29H36FN5O3 |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 2-amino-N-[1-[6-(1-benzyl-6-fluoroindol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-methoxy-1-oxobutan-2-yl]propanamide |
| SMILES | COC(C)C(NC(=O)C(C)N)C(=O)N1CCC2NCC(c3cn(Cc4ccccc4)c4cc(F)ccc34)C21 |
| InChI | InChI=1S/C29H36FN5O3/c1-17(31)28(36)33-26(18(2)38-3)29(37)35-12-11-24-27(35)22(14-32-24)23-16-34(15-19-7-5-4-6-8-19)25-13-20(30)9-10-21(23)25/h4-10,13,16-18,22,24,26-27,32H,11-12,14-15,31H2,1-3H3,(H,33,36) |
| InChIKey | LDUBECIZUPSFRT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |