C23H33N5O3 — CID 143960674
(2S)-N-[(2S)-1-[(6S,6aR)-6-(1H-indol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-methoxy-1-oxobutan-2-yl]-2-(methylamino)propanamide (PubChem CID 143960674) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[(6S,6aR)-6-(1H-indol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-methoxy-1-oxobutan-2-yl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[(2S)-1-[(6S,6aR)-6-(1H-indol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-methoxy-1-oxobutan-2-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 143960674 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (2S)-N-[(2S)-1-[(6S,6aR)-6-(1H-indol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-methoxy-1-oxobutan-2-yl]-2-(methylamino)propanamide |
| SMILES | CN[C@@H](C)C(=O)N[C@H](C(=O)N1CCC2NC[C@H](c3c[nH]c4ccccc34)[C@H]21)C(C)OC |
| InChI | InChI=1S/C23H33N5O3/c1-13(24-3)22(29)27-20(14(2)31-4)23(30)28-10-9-19-21(28)17(12-26-19)16-11-25-18-8-6-5-7-15(16)18/h5-8,11,13-14,17,19-21,24-26H,9-10,12H2,1-4H3,(H,27,29)/t13-,14?,17+,19?,20-,21+/m0/s1 |
| InChIKey | MOIZOMCYPKFWQB-OSYPYTEDSA-N |
| XLogP | 0.95 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |