C34H42FN5O5 — CID 67410861
benzyl 4-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-6a-(6-fluoro-1H-indol-3-yl)-6-hydroxy-3,3a,5,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate (PubChem CID 67410861) has the molecular formula C34H42FN5O5 and a molecular weight of 619.74 g/mol. Its IUPAC name is benzyl 4-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-6a-(6-fluoro-1H-indol-3-yl)-6-hydroxy-3,3a,5,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate.
| Compound Name | benzyl 4-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-6a-(6-fluoro-1H-indol-3-yl)-6-hydroxy-3,3a,5,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 67410861 |
| Molecular Formula | C34H42FN5O5 |
| Molecular Weight | 619.74 g/mol |
| Exact Mass | 619.32 |
| IUPAC Name | benzyl 4-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-6a-(6-fluoro-1H-indol-3-yl)-6-hydroxy-3,3a,5,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate |
| SMILES | CNC(C)C(=O)NC(C(=O)N1CC(O)C2(c3c[nH]c4cc(F)ccc34)C1CCN2C(=O)OCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C34H42FN5O5/c1-21(36-2)31(42)38-30(23-11-7-4-8-12-23)32(43)39-19-29(41)34(26-18-37-27-17-24(35)13-14-25(26)27)28(39)15-16-40(34)33(44)45-20-22-9-5-3-6-10-22/h3,5-6,9-10,13-14,17-18,21,23,28-30,36-37,41H,4,7-8,11-12,15-16,19-20H2,1-2H3,(H,38,42) |
| InChIKey | YRESRYDXWKJNMY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.74 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |