C18H26FN3O — CID 142706635
2-amino-1-[7-[(4-fluorophenyl)methyl]-3,7-diazabicyclo[4.1.0]heptan-3-yl]-3,3-dimethylbutan-1-one (PubChem CID 142706635) has the molecular formula C18H26FN3O and a molecular weight of 319.42 g/mol. Its IUPAC name is 2-amino-1-[7-[(4-fluorophenyl)methyl]-3,7-diazabicyclo[4.1.0]heptan-3-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 2-amino-1-[7-[(4-fluorophenyl)methyl]-3,7-diazabicyclo[4.1.0]heptan-3-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 142706635 |
| Molecular Formula | C18H26FN3O |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 2-amino-1-[7-[(4-fluorophenyl)methyl]-3,7-diazabicyclo[4.1.0]heptan-3-yl]-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)C(N)C(=O)N1CCC2C(C1)N2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H26FN3O/c1-18(2,3)16(20)17(23)21-9-8-14-15(11-21)22(14)10-12-4-6-13(19)7-5-12/h4-7,14-16H,8-11,20H2,1-3H3 |
| InChIKey | OKPZDTKPBXETAM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|