C31H42N4O3 — CID 59679717
N-[1-[(2S)-3-methyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-6-yl]-2,2-diphenylpropanamide (PubChem CID 59679717) has the molecular formula C31H42N4O3 and a molecular weight of 518.70 g/mol. Its IUPAC name is N-[1-[(2S)-3-methyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-6-yl]-2,2-diphenylpropanamide.
| Compound Name | N-[1-[(2S)-3-methyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-6-yl]-2,2-diphenylpropanamide |
|---|---|
| PubChem CID | 59679717 |
| Molecular Formula | C31H42N4O3 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | N-[1-[(2S)-3-methyl-2-[[(2S)-2-(methylamino)propanoyl]amino]butanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-6-yl]-2,2-diphenylpropanamide |
| SMILES | CN[C@@H](C)C(=O)N[C@H](C(=O)N1CCC2CCC(NC(=O)C(C)(c3ccccc3)c3ccccc3)C21)C(C)C |
| InChI | InChI=1S/C31H42N4O3/c1-20(2)26(34-28(36)21(3)32-5)29(37)35-19-18-22-16-17-25(27(22)35)33-30(38)31(4,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-15,20-22,25-27,32H,16-19H2,1-5H3,(H,33,38)(H,34,36)/t21-,22?,25?,26-,27?/m0/s1 |
| InChIKey | ZZSIOJYPTPLECO-VUCHFPIMSA-N |
| XLogP | 3.24 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |