C25H37N3O9 — CID 59947197
methyl (2S)-6-(methylperoxymethyl)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)propanoyl]piperidine-2-carboxylate (PubChem CID 59947197) has the molecular formula C25H37N3O9 and a molecular weight of 523.58 g/mol. Its IUPAC name is methyl (2S)-6-(methylperoxymethyl)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)propanoyl]piperidine-2-carboxylate.
| Compound Name | methyl (2S)-6-(methylperoxymethyl)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)propanoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 59947197 |
| Molecular Formula | C25H37N3O9 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | methyl (2S)-6-(methylperoxymethyl)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)propanoyl]piperidine-2-carboxylate |
| SMILES | COOCC1CCC[C@@H](C(=O)OC)N1C(=O)[C@H](CNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H37N3O9/c1-25(2,3)37-24(32)27-19(14-26-23(31)35-15-17-10-7-6-8-11-17)21(29)28-18(16-36-34-5)12-9-13-20(28)22(30)33-4/h6-8,10-11,18-20H,9,12-16H2,1-5H3,(H,26,31)(H,27,32)/t18?,19-,20-/m0/s1 |
| InChIKey | HDHIRLXXUKUIRS-YPJRHXLCSA-N |
| XLogP | 2.31 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|