C39H36N2O7 — CID 157411094
benzyl 4-oxo-2-(2-oxoethyl)-2,3-dihydroquinoline-1-carboxylate;benzyl 4-oxo-2-prop-2-enyl-2,3-dihydroquinoline-1-carboxylate (PubChem CID 157411094) has the molecular formula C39H36N2O7 and a molecular weight of 644.72 g/mol. Its IUPAC name is benzyl 4-oxo-2-(2-oxoethyl)-2,3-dihydroquinoline-1-carboxylate;benzyl 4-oxo-2-prop-2-enyl-2,3-dihydroquinoline-1-carboxylate.
| Compound Name | benzyl 4-oxo-2-(2-oxoethyl)-2,3-dihydroquinoline-1-carboxylate;benzyl 4-oxo-2-prop-2-enyl-2,3-dihydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 157411094 |
| Molecular Formula | C39H36N2O7 |
| Molecular Weight | 644.72 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | benzyl 4-oxo-2-(2-oxoethyl)-2,3-dihydroquinoline-1-carboxylate;benzyl 4-oxo-2-prop-2-enyl-2,3-dihydroquinoline-1-carboxylate |
| SMILES | C=CCC1CC(=O)c2ccccc2N1C(=O)OCc1ccccc1.O=CCC1CC(=O)c2ccccc2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H19NO3.C19H17NO4/c1-2-8-16-13-19(22)17-11-6-7-12-18(17)21(16)20(23)24-14-15-9-4-3-5-10-15;21-11-10-15-12-18(22)16-8-4-5-9-17(16)20(15)19(23)24-13-14-6-2-1-3-7-14/h2-7,9-12,16H,1,8,13-14H2;1-9,11,15H,10,12-13H2 |
| InChIKey | BOHJJOHZEDVSSN-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.72 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|