C17H18N2O3 — CID 19795229
benzyl 2-[amino(hydroxy)methyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 19795229) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is benzyl 2-[amino(hydroxy)methyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | benzyl 2-[amino(hydroxy)methyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 19795229 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | benzyl 2-[amino(hydroxy)methyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | NC(O)C1Cc2ccccc2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H18N2O3/c18-16(20)15-10-13-8-4-5-9-14(13)19(15)17(21)22-11-12-6-2-1-3-7-12/h1-9,15-16,20H,10-11,18H2 |
| InChIKey | SRODWVUQFFEHMM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|