C24H22N4O4 — CID 124563083
benzyl (2R)-2-[(2-amino-3-carbamoylphenyl)carbamoyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 124563083) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is benzyl (2R)-2-[(2-amino-3-carbamoylphenyl)carbamoyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | benzyl (2R)-2-[(2-amino-3-carbamoylphenyl)carbamoyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 124563083 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | benzyl (2R)-2-[(2-amino-3-carbamoylphenyl)carbamoyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | NC(=O)c1cccc(NC(=O)[C@H]2Cc3ccccc3N2C(=O)OCc2ccccc2)c1N |
| InChI | InChI=1S/C24H22N4O4/c25-21-17(22(26)29)10-6-11-18(21)27-23(30)20-13-16-9-4-5-12-19(16)28(20)24(31)32-14-15-7-2-1-3-8-15/h1-12,20H,13-14,25H2,(H2,26,29)(H,27,30)/t20-/m1/s1 |
| InChIKey | FFMJOOSPYVEZJD-HXUWFJFHSA-N |
| XLogP | 3.07 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|