C17H17N3O2 — CID 41429200
(2S)-1-N-benzyl-2,3-dihydroindole-1,2-dicarboxamide (PubChem CID 41429200) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is (2S)-1-N-benzyl-2,3-dihydroindole-1,2-dicarboxamide.
| Compound Name | (2S)-1-N-benzyl-2,3-dihydroindole-1,2-dicarboxamide |
|---|---|
| PubChem CID | 41429200 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (2S)-1-N-benzyl-2,3-dihydroindole-1,2-dicarboxamide |
| SMILES | NC(=O)[C@@H]1Cc2ccccc2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H17N3O2/c18-16(21)15-10-13-8-4-5-9-14(13)20(15)17(22)19-11-12-6-2-1-3-7-12/h1-9,15H,10-11H2,(H2,18,21)(H,19,22)/t15-/m0/s1 |
| InChIKey | PCBXWCABUSXZED-HNNXBMFYSA-N |
| XLogP | 1.81 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |