C9H10N2O2 — CID 154385524
1-hydroxy-2,3-dihydroindole-2-carboxamide (PubChem CID 154385524) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 1-hydroxy-2,3-dihydroindole-2-carboxamide.
| Compound Name | 1-hydroxy-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 154385524 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 1-hydroxy-2,3-dihydroindole-2-carboxamide |
| SMILES | NC(=O)C1Cc2ccccc2N1O |
| InChI | InChI=1S/C9H10N2O2/c10-9(12)8-5-6-3-1-2-4-7(6)11(8)13/h1-4,8,13H,5H2,(H2,10,12) |
| InChIKey | JLAIJFBQTXJFDS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |