C18H18N2O2 — CID 40829167
(2R)-1-(3,4-dimethylbenzoyl)-2,3-dihydroindole-2-carboxamide (PubChem CID 40829167) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is (2R)-1-(3,4-dimethylbenzoyl)-2,3-dihydroindole-2-carboxamide.
| Compound Name | (2R)-1-(3,4-dimethylbenzoyl)-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 40829167 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (2R)-1-(3,4-dimethylbenzoyl)-2,3-dihydroindole-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N2c3ccccc3C[C@@H]2C(N)=O)cc1C |
| InChI | InChI=1S/C18H18N2O2/c1-11-7-8-14(9-12(11)2)18(22)20-15-6-4-3-5-13(15)10-16(20)17(19)21/h3-9,16H,10H2,1-2H3,(H2,19,21)/t16-/m1/s1 |
| InChIKey | KZAQEONQBGKHFU-MRXNPFEDSA-N |
| XLogP | 2.36 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |