C18H17NO5 — CID 118856568
1-(3,4-dimethoxybenzoyl)-2,3-dihydroindole-2-carboxylic acid (PubChem CID 118856568) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 1-(3,4-dimethoxybenzoyl)-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | 1-(3,4-dimethoxybenzoyl)-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 118856568 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 1-(3,4-dimethoxybenzoyl)-2,3-dihydroindole-2-carboxylic acid |
| SMILES | COc1ccc(C(=O)N2c3ccccc3CC2C(=O)O)cc1OC |
| InChI | InChI=1S/C18H17NO5/c1-23-15-8-7-12(10-16(15)24-2)17(20)19-13-6-4-3-5-11(13)9-14(19)18(21)22/h3-8,10,14H,9H2,1-2H3,(H,21,22) |
| InChIKey | HDFVRSRWBFZGSA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |