C19H20N2O5 — CID 41428756
(2S)-1-(3,4,5-trimethoxybenzoyl)-2,3-dihydroindole-2-carboxamide (PubChem CID 41428756) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is (2S)-1-(3,4,5-trimethoxybenzoyl)-2,3-dihydroindole-2-carboxamide.
| Compound Name | (2S)-1-(3,4,5-trimethoxybenzoyl)-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 41428756 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (2S)-1-(3,4,5-trimethoxybenzoyl)-2,3-dihydroindole-2-carboxamide |
| SMILES | COc1cc(C(=O)N2c3ccccc3C[C@H]2C(N)=O)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N2O5/c1-24-15-9-12(10-16(25-2)17(15)26-3)19(23)21-13-7-5-4-6-11(13)8-14(21)18(20)22/h4-7,9-10,14H,8H2,1-3H3,(H2,20,22)/t14-/m0/s1 |
| InChIKey | QDWQBQGJDBDRMV-AWEZNQCLSA-N |
| XLogP | 1.77 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |