C23H26N2O6 — CID 20697348
1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-N-propan-2-yl-2,3-dihydroindole-2-carboxamide (PubChem CID 20697348) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-N-propan-2-yl-2,3-dihydroindole-2-carboxamide.
| Compound Name | 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-N-propan-2-yl-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 20697348 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-N-propan-2-yl-2,3-dihydroindole-2-carboxamide |
| SMILES | COc1cc(C(=O)C(=O)N2c3ccccc3CC2C(=O)NC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C23H26N2O6/c1-13(2)24-22(27)17-10-14-8-6-7-9-16(14)25(17)23(28)20(26)15-11-18(29-3)21(31-5)19(12-15)30-4/h6-9,11-13,17H,10H2,1-5H3,(H,24,27) |
| InChIKey | DIVHXIREYYUZJS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|