C40H44N2O5 — CID 20697323
2-[2-(3,5-dimethoxy-4-methylphenyl)-2-oxoacetyl]-N-(1,7-diphenylheptan-4-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 20697323) has the molecular formula C40H44N2O5 and a molecular weight of 632.80 g/mol. Its IUPAC name is 2-[2-(3,5-dimethoxy-4-methylphenyl)-2-oxoacetyl]-N-(1,7-diphenylheptan-4-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | 2-[2-(3,5-dimethoxy-4-methylphenyl)-2-oxoacetyl]-N-(1,7-diphenylheptan-4-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 20697323 |
| Molecular Formula | C40H44N2O5 |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.33 |
| IUPAC Name | 2-[2-(3,5-dimethoxy-4-methylphenyl)-2-oxoacetyl]-N-(1,7-diphenylheptan-4-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | COc1cc(C(=O)C(=O)N2Cc3ccccc3CC2C(=O)NC(CCCc2ccccc2)CCCc2ccccc2)cc(OC)c1C |
| InChI | InChI=1S/C40H44N2O5/c1-28-36(46-2)25-33(26-37(28)47-3)38(43)40(45)42-27-32-21-11-10-20-31(32)24-35(42)39(44)41-34(22-12-18-29-14-6-4-7-15-29)23-13-19-30-16-8-5-9-17-30/h4-11,14-17,20-21,25-26,34-35H,12-13,18-19,22-24,27H2,1-3H3,(H,41,44) |
| InChIKey | JWQPRKXCOXJLHM-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|