C29H34N2O — CID 15546996
(3S)-N-(1,7-diphenylheptan-4-yl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 15546996) has the molecular formula C29H34N2O and a molecular weight of 426.60 g/mol. Its IUPAC name is (3S)-N-(1,7-diphenylheptan-4-yl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3S)-N-(1,7-diphenylheptan-4-yl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 15546996 |
| Molecular Formula | C29H34N2O |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | (3S)-N-(1,7-diphenylheptan-4-yl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | O=C(NC(CCCc1ccccc1)CCCc1ccccc1)[C@@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C29H34N2O/c32-29(28-21-25-17-7-8-18-26(25)22-30-28)31-27(19-9-15-23-11-3-1-4-12-23)20-10-16-24-13-5-2-6-14-24/h1-8,11-14,17-18,27-28,30H,9-10,15-16,19-22H2,(H,31,32)/t28-/m0/s1 |
| InChIKey | SVYKYHUWKKAVEG-NDEPHWFRSA-N |
| XLogP | 5.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |