C17H18N2O2 — CID 11044233
(3R)-N-phenylmethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 11044233) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is (3R)-N-phenylmethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3R)-N-phenylmethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 11044233 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (3R)-N-phenylmethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | O=C(NOCc1ccccc1)[C@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C17H18N2O2/c20-17(19-21-12-13-6-2-1-3-7-13)16-10-14-8-4-5-9-15(14)11-18-16/h1-9,16,18H,10-12H2,(H,19,20)/t16-/m1/s1 |
| InChIKey | SNIAOYGCWJUAQL-MRXNPFEDSA-N |
| XLogP | 1.95 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|