C31H34N2O5 — CID 59966338
(3S)-2-[2-(3,5-dimethoxy-4-methylphenyl)-2-oxoacetyl]-N-(4-phenylbutyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 59966338) has the molecular formula C31H34N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is (3S)-2-[2-(3,5-dimethoxy-4-methylphenyl)-2-oxoacetyl]-N-(4-phenylbutyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-2-[2-(3,5-dimethoxy-4-methylphenyl)-2-oxoacetyl]-N-(4-phenylbutyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 59966338 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | (3S)-2-[2-(3,5-dimethoxy-4-methylphenyl)-2-oxoacetyl]-N-(4-phenylbutyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | COc1cc(C(=O)C(=O)N2Cc3ccccc3C[C@H]2C(=O)NCCCCc2ccccc2)cc(OC)c1C |
| InChI | InChI=1S/C31H34N2O5/c1-21-27(37-2)18-25(19-28(21)38-3)29(34)31(36)33-20-24-15-8-7-14-23(24)17-26(33)30(35)32-16-10-9-13-22-11-5-4-6-12-22/h4-8,11-12,14-15,18-19,26H,9-10,13,16-17,20H2,1-3H3,(H,32,35)/t26-/m0/s1 |
| InChIKey | AMSMOLMQGJSHAZ-SANMLTNESA-N |
| XLogP | 4.29 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|