C41H46N4O5 — CID 129017780
[1-(2,2-diphenylethylamino)-1-oxo-6-[[2-(4-phenylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]hexan-2-yl]carbamic acid (PubChem CID 129017780) has the molecular formula C41H46N4O5 and a molecular weight of 674.84 g/mol. Its IUPAC name is [1-(2,2-diphenylethylamino)-1-oxo-6-[[2-(4-phenylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]hexan-2-yl]carbamic acid.
| Compound Name | [1-(2,2-diphenylethylamino)-1-oxo-6-[[2-(4-phenylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]hexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 129017780 |
| Molecular Formula | C41H46N4O5 |
| Molecular Weight | 674.84 g/mol |
| Exact Mass | 674.35 |
| IUPAC Name | [1-(2,2-diphenylethylamino)-1-oxo-6-[[2-(4-phenylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]hexan-2-yl]carbamic acid |
| SMILES | O=C(O)NC(CCCCNC(=O)C1Cc2ccccc2CN1C(=O)CCCc1ccccc1)C(=O)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H46N4O5/c46-38(25-14-17-30-15-4-1-5-16-30)45-29-34-23-11-10-22-33(34)27-37(45)40(48)42-26-13-12-24-36(44-41(49)50)39(47)43-28-35(31-18-6-2-7-19-31)32-20-8-3-9-21-32/h1-11,15-16,18-23,35-37,44H,12-14,17,24-29H2,(H,42,48)(H,43,47)(H,49,50) |
| InChIKey | PFMQPBRLWVXOTG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.84 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|