C29H30N2O7 — CID 20707822
3-pyridin-3-ylpropyl 2-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 20707822) has the molecular formula C29H30N2O7 and a molecular weight of 518.57 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 2-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | 3-pyridin-3-ylpropyl 2-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 20707822 |
| Molecular Formula | C29H30N2O7 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 3-pyridin-3-ylpropyl 2-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | COc1cc(C(=O)C(=O)N2Cc3ccccc3CC2C(=O)OCCCc2cccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H30N2O7/c1-35-24-15-22(16-25(36-2)27(24)37-3)26(32)28(33)31-18-21-11-5-4-10-20(21)14-23(31)29(34)38-13-7-9-19-8-6-12-30-17-19/h4-6,8,10-12,15-17,23H,7,9,13-14,18H2,1-3H3 |
| InChIKey | JFGOSDKKFKZNMX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 104.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|