C23H27N3O7 — CID 20653291
[1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]pyrrolidin-2-yl]methyl N-(pyridin-3-ylmethyl)carbamate (PubChem CID 20653291) has the molecular formula C23H27N3O7 and a molecular weight of 457.48 g/mol. Its IUPAC name is [1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]pyrrolidin-2-yl]methyl N-(pyridin-3-ylmethyl)carbamate.
| Compound Name | [1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]pyrrolidin-2-yl]methyl N-(pyridin-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 20653291 |
| Molecular Formula | C23H27N3O7 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | [1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]pyrrolidin-2-yl]methyl N-(pyridin-3-ylmethyl)carbamate |
| SMILES | COc1cc(C(=O)C(=O)N2CCCC2COC(=O)NCc2cccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H27N3O7/c1-30-18-10-16(11-19(31-2)21(18)32-3)20(27)22(28)26-9-5-7-17(26)14-33-23(29)25-13-15-6-4-8-24-12-15/h4,6,8,10-12,17H,5,7,9,13-14H2,1-3H3,(H,25,29) |
| InChIKey | VFIXRTAADNBZPN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|