C27H36N2O4 — CID 142038699
ethane;3-pyridin-3-ylpropyl 2-(3,3-dimethyl-2-oxopentanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 142038699) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is ethane;3-pyridin-3-ylpropyl 2-(3,3-dimethyl-2-oxopentanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | ethane;3-pyridin-3-ylpropyl 2-(3,3-dimethyl-2-oxopentanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 142038699 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | ethane;3-pyridin-3-ylpropyl 2-(3,3-dimethyl-2-oxopentanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | CC.CCC(C)(C)C(=O)C(=O)N1Cc2ccccc2CC1C(=O)OCCCc1cccnc1 |
| InChI | InChI=1S/C25H30N2O4.C2H6/c1-4-25(2,3)22(28)23(29)27-17-20-12-6-5-11-19(20)15-21(27)24(30)31-14-8-10-18-9-7-13-26-16-18;1-2/h5-7,9,11-13,16,21H,4,8,10,14-15,17H2,1-3H3;1-2H3 |
| InChIKey | WYXYZQKKFNBFAN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|