C21H30N2O3 — CID 163689088
3-pyridin-3-ylpropyl (2S)-1-(4,4-dimethyl-3-oxohex-1-en-2-yl)pyrrolidine-2-carboxylate (PubChem CID 163689088) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl (2S)-1-(4,4-dimethyl-3-oxohex-1-en-2-yl)pyrrolidine-2-carboxylate.
| Compound Name | 3-pyridin-3-ylpropyl (2S)-1-(4,4-dimethyl-3-oxohex-1-en-2-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 163689088 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 3-pyridin-3-ylpropyl (2S)-1-(4,4-dimethyl-3-oxohex-1-en-2-yl)pyrrolidine-2-carboxylate |
| SMILES | C=C(C(=O)C(C)(C)CC)N1CCC[C@H]1C(=O)OCCCc1cccnc1 |
| InChI | InChI=1S/C21H30N2O3/c1-5-21(3,4)19(24)16(2)23-13-7-11-18(23)20(25)26-14-8-10-17-9-6-12-22-15-17/h6,9,12,15,18H,2,5,7-8,10-11,13-14H2,1,3-4H3/t18-/m0/s1 |
| InChIKey | JRKDRGZLHLHEMM-SFHVURJKSA-N |
| XLogP | 3.54 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|