C21H27N3O4S — CID 134138086
3-pyridin-3-ylpropyl 1-[(3-aminophenyl)methylsulfonyl]piperidine-2-carboxylate (PubChem CID 134138086) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 1-[(3-aminophenyl)methylsulfonyl]piperidine-2-carboxylate.
| Compound Name | 3-pyridin-3-ylpropyl 1-[(3-aminophenyl)methylsulfonyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 134138086 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 3-pyridin-3-ylpropyl 1-[(3-aminophenyl)methylsulfonyl]piperidine-2-carboxylate |
| SMILES | Nc1cccc(CS(=O)(=O)N2CCCCC2C(=O)OCCCc2cccnc2)c1 |
| InChI | InChI=1S/C21H27N3O4S/c22-19-9-3-6-18(14-19)16-29(26,27)24-12-2-1-10-20(24)21(25)28-13-5-8-17-7-4-11-23-15-17/h3-4,6-7,9,11,14-15,20H,1-2,5,8,10,12-13,16,22H2 |
| InChIKey | LQIJPNFAXAXJTQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|