C24H31N3O5S — CID 169192470
[1-oxo-1-(pyridin-3-ylmethylamino)pentan-2-yl] 1-benzylsulfonylpiperidine-2-carboxylate (PubChem CID 169192470) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is [1-oxo-1-(pyridin-3-ylmethylamino)pentan-2-yl] 1-benzylsulfonylpiperidine-2-carboxylate.
| Compound Name | [1-oxo-1-(pyridin-3-ylmethylamino)pentan-2-yl] 1-benzylsulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 169192470 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | [1-oxo-1-(pyridin-3-ylmethylamino)pentan-2-yl] 1-benzylsulfonylpiperidine-2-carboxylate |
| SMILES | CCCC(OC(=O)C1CCCCN1S(=O)(=O)Cc1ccccc1)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C24H31N3O5S/c1-2-9-22(23(28)26-17-20-12-8-14-25-16-20)32-24(29)21-13-6-7-15-27(21)33(30,31)18-19-10-4-3-5-11-19/h3-5,8,10-12,14,16,21-22H,2,6-7,9,13,15,17-18H2,1H3,(H,26,28) |
| InChIKey | YFLXVKMHKQRJDV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |