C47H50N2O6 — CID 59966310
(1S,3S)-1-benzyl-N-(1,7-diphenylheptan-4-yl)-2-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 59966310) has the molecular formula C47H50N2O6 and a molecular weight of 738.93 g/mol. Its IUPAC name is (1S,3S)-1-benzyl-N-(1,7-diphenylheptan-4-yl)-2-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (1S,3S)-1-benzyl-N-(1,7-diphenylheptan-4-yl)-2-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 59966310 |
| Molecular Formula | C47H50N2O6 |
| Molecular Weight | 738.93 g/mol |
| Exact Mass | 738.37 |
| IUPAC Name | (1S,3S)-1-benzyl-N-(1,7-diphenylheptan-4-yl)-2-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | COc1cc(C(=O)C(=O)N2[C@H](C(=O)NC(CCCc3ccccc3)CCCc3ccccc3)Cc3ccccc3[C@@H]2Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C47H50N2O6/c1-53-42-31-37(32-43(54-2)45(42)55-3)44(50)47(52)49-40(29-35-21-11-6-12-22-35)39-28-14-13-25-36(39)30-41(49)46(51)48-38(26-15-23-33-17-7-4-8-18-33)27-16-24-34-19-9-5-10-20-34/h4-14,17-22,25,28,31-32,38,40-41H,15-16,23-24,26-27,29-30H2,1-3H3,(H,48,51)/t40-,41-/m0/s1 |
| InChIKey | FKIWNQINKCRYJV-YATWDLPUSA-N |
| XLogP | 8.16 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.93 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|