C39H48N2O8 — CID 10233518
1-[3-[1-(3,4-dimethoxyphenyl)-7-phenylheptan-4-yl]-2-oxo-3,9-diazabicyclo[3.3.1]nonan-9-yl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione (PubChem CID 10233518) has the molecular formula C39H48N2O8 and a molecular weight of 672.82 g/mol. Its IUPAC name is 1-[3-[1-(3,4-dimethoxyphenyl)-7-phenylheptan-4-yl]-2-oxo-3,9-diazabicyclo[3.3.1]nonan-9-yl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-[3-[1-(3,4-dimethoxyphenyl)-7-phenylheptan-4-yl]-2-oxo-3,9-diazabicyclo[3.3.1]nonan-9-yl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 10233518 |
| Molecular Formula | C39H48N2O8 |
| Molecular Weight | 672.82 g/mol |
| Exact Mass | 672.34 |
| IUPAC Name | 1-[3-[1-(3,4-dimethoxyphenyl)-7-phenylheptan-4-yl]-2-oxo-3,9-diazabicyclo[3.3.1]nonan-9-yl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione |
| SMILES | COc1ccc(CCCC(CCCc2ccccc2)N2CC3CCCC(C2=O)N3C(=O)C(=O)c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C39H48N2O8/c1-45-32-21-20-27(22-33(32)46-2)15-10-17-29(16-9-14-26-12-7-6-8-13-26)40-25-30-18-11-19-31(38(40)43)41(30)39(44)36(42)28-23-34(47-3)37(49-5)35(24-28)48-4/h6-8,12-13,20-24,29-31H,9-11,14-19,25H2,1-5H3 |
| InChIKey | ZNEHQCWVUACLIV-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.82 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|