C28H34N2O9 — CID 71662583
1-[(1S,5R)-3-[2-(3,4-dimethoxyphenoxy)ethyl]-2-oxo-3,9-diazabicyclo[3.3.1]nonan-9-yl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione (PubChem CID 71662583) has the molecular formula C28H34N2O9 and a molecular weight of 542.59 g/mol. Its IUPAC name is 1-[(1S,5R)-3-[2-(3,4-dimethoxyphenoxy)ethyl]-2-oxo-3,9-diazabicyclo[3.3.1]nonan-9-yl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-[(1S,5R)-3-[2-(3,4-dimethoxyphenoxy)ethyl]-2-oxo-3,9-diazabicyclo[3.3.1]nonan-9-yl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 71662583 |
| Molecular Formula | C28H34N2O9 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 1-[(1S,5R)-3-[2-(3,4-dimethoxyphenoxy)ethyl]-2-oxo-3,9-diazabicyclo[3.3.1]nonan-9-yl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione |
| SMILES | COc1ccc(OCCN2C[C@H]3CCC[C@@H](C2=O)N3C(=O)C(=O)c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C28H34N2O9/c1-34-21-10-9-19(15-22(21)35-2)39-12-11-29-16-18-7-6-8-20(27(29)32)30(18)28(33)25(31)17-13-23(36-3)26(38-5)24(14-17)37-4/h9-10,13-15,18,20H,6-8,11-12,16H2,1-5H3/t18-,20+/m1/s1 |
| InChIKey | PLKKCLVMJKZZQP-QUCCMNQESA-N |
| XLogP | 2.58 |
| TPSA | 113.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|