C27H30N2O6 — CID 21363715
1-(13-oxo-12,18-diazatetracyclo[12.3.1.02,12.03,8]octadeca-3,5,7-trien-18-yl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione (PubChem CID 21363715) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is 1-(13-oxo-12,18-diazatetracyclo[12.3.1.02,12.03,8]octadeca-3,5,7-trien-18-yl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-(13-oxo-12,18-diazatetracyclo[12.3.1.02,12.03,8]octadeca-3,5,7-trien-18-yl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 21363715 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 1-(13-oxo-12,18-diazatetracyclo[12.3.1.02,12.03,8]octadeca-3,5,7-trien-18-yl)-2-(3,4,5-trimethoxyphenyl)ethane-1,2-dione |
| SMILES | COc1cc(C(=O)C(=O)N2C3CCCC2C2c4ccccc4CCCN2C3=O)cc(OC)c1OC |
| InChI | InChI=1S/C27H30N2O6/c1-33-21-14-17(15-22(34-2)25(21)35-3)24(30)27(32)29-19-11-6-12-20(29)26(31)28-13-7-9-16-8-4-5-10-18(16)23(19)28/h4-5,8,10,14-15,19-20,23H,6-7,9,11-13H2,1-3H3 |
| InChIKey | LZUKIVHUDOTBKD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|