C25H25ClN2O5 — CID 11669966
1-(2-chlorophenyl)-2-[(1R,13S)-4,6-dimethoxy-12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-trien-17-yl]ethane-1,2-dione (PubChem CID 11669966) has the molecular formula C25H25ClN2O5 and a molecular weight of 468.94 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-[(1R,13S)-4,6-dimethoxy-12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-trien-17-yl]ethane-1,2-dione.
| Compound Name | 1-(2-chlorophenyl)-2-[(1R,13S)-4,6-dimethoxy-12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-trien-17-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 11669966 |
| Molecular Formula | C25H25ClN2O5 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 1-(2-chlorophenyl)-2-[(1R,13S)-4,6-dimethoxy-12-oxo-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-trien-17-yl]ethane-1,2-dione |
| SMILES | COc1cc2c(c(OC)c1)C1[C@H]3CCC[C@@H](C(=O)N1CC2)N3C(=O)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C25H25ClN2O5/c1-32-15-12-14-10-11-27-22(21(14)20(13-15)33-2)18-8-5-9-19(24(27)30)28(18)25(31)23(29)16-6-3-4-7-17(16)26/h3-4,6-7,12-13,18-19,22H,5,8-11H2,1-2H3/t18-,19+,22?/m1/s1 |
| InChIKey | YIBHQTIQLGZXPQ-DKPCLATOSA-N |
| XLogP | 3.43 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|