C23H35N3O4S — CID 142184718
4-[(2,6-dimethylmorpholin-4-yl)sulfanyl-methylamino]-10,12-dimethoxy-2,3,4,7,8,12b-hexahydro-1H-azepino[2,1-a]isoquinolin-5-one (PubChem CID 142184718) has the molecular formula C23H35N3O4S and a molecular weight of 449.62 g/mol. Its IUPAC name is 4-[(2,6-dimethylmorpholin-4-yl)sulfanyl-methylamino]-10,12-dimethoxy-2,3,4,7,8,12b-hexahydro-1H-azepino[2,1-a]isoquinolin-5-one.
| Compound Name | 4-[(2,6-dimethylmorpholin-4-yl)sulfanyl-methylamino]-10,12-dimethoxy-2,3,4,7,8,12b-hexahydro-1H-azepino[2,1-a]isoquinolin-5-one |
|---|---|
| PubChem CID | 142184718 |
| Molecular Formula | C23H35N3O4S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 4-[(2,6-dimethylmorpholin-4-yl)sulfanyl-methylamino]-10,12-dimethoxy-2,3,4,7,8,12b-hexahydro-1H-azepino[2,1-a]isoquinolin-5-one |
| SMILES | COc1cc2c(c(OC)c1)C1CCCC(N(C)SN3CC(C)OC(C)C3)C(=O)N1CC2 |
| InChI | InChI=1S/C23H35N3O4S/c1-15-13-25(14-16(2)30-15)31-24(3)20-8-6-7-19-22-17(9-10-26(19)23(20)27)11-18(28-4)12-21(22)29-5/h11-12,15-16,19-20H,6-10,13-14H2,1-5H3 |
| InChIKey | DSHUWDXVAZGWSX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|