C25H27FN2O4 — CID 142184743
17-[2-(4-fluorophenyl)-2-oxoethyl]-4,6-dimethoxy-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-trien-12-one (PubChem CID 142184743) has the molecular formula C25H27FN2O4 and a molecular weight of 438.50 g/mol. Its IUPAC name is 17-[2-(4-fluorophenyl)-2-oxoethyl]-4,6-dimethoxy-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-trien-12-one.
| Compound Name | 17-[2-(4-fluorophenyl)-2-oxoethyl]-4,6-dimethoxy-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-trien-12-one |
|---|---|
| PubChem CID | 142184743 |
| Molecular Formula | C25H27FN2O4 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 17-[2-(4-fluorophenyl)-2-oxoethyl]-4,6-dimethoxy-11,17-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-3(8),4,6-trien-12-one |
| SMILES | COc1cc2c(c(OC)c1)C1C3CCCC(C(=O)N1CC2)N3CC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H27FN2O4/c1-31-18-12-16-10-11-27-24(23(16)22(13-18)32-2)19-4-3-5-20(25(27)30)28(19)14-21(29)15-6-8-17(26)9-7-15/h6-9,12-13,19-20,24H,3-5,10-11,14H2,1-2H3 |
| InChIKey | HQKBZLCSDQMBIN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |