C26H30Cl2N2O4 — CID 142184785
1-(3,4-dichlorophenyl)-2-(9,11-dimethoxy-1-methyl-3-propyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-2-yl)ethane-1,2-dione (PubChem CID 142184785) has the molecular formula C26H30Cl2N2O4 and a molecular weight of 505.44 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-(9,11-dimethoxy-1-methyl-3-propyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-2-yl)ethane-1,2-dione.
| Compound Name | 1-(3,4-dichlorophenyl)-2-(9,11-dimethoxy-1-methyl-3-propyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 142184785 |
| Molecular Formula | C26H30Cl2N2O4 |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-(9,11-dimethoxy-1-methyl-3-propyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-2-yl)ethane-1,2-dione |
| SMILES | CCCC1CN2CCc3cc(OC)cc(OC)c3C2C(C)N1C(=O)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H30Cl2N2O4/c1-5-6-18-14-29-10-9-16-11-19(33-3)13-22(34-4)23(16)24(29)15(2)30(18)26(32)25(31)17-7-8-20(27)21(28)12-17/h7-8,11-13,15,18,24H,5-6,9-10,14H2,1-4H3 |
| InChIKey | DJJULRZBYZEXFR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|