C23H29NO4 — CID 101157458
butyl (1R)-2-benzyl-6,8-dimethoxy-3,4-dihydro-1H-isoquinoline-1-carboxylate (PubChem CID 101157458) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is butyl (1R)-2-benzyl-6,8-dimethoxy-3,4-dihydro-1H-isoquinoline-1-carboxylate.
| Compound Name | butyl (1R)-2-benzyl-6,8-dimethoxy-3,4-dihydro-1H-isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 101157458 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | butyl (1R)-2-benzyl-6,8-dimethoxy-3,4-dihydro-1H-isoquinoline-1-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1c2c(cc(OC)cc2OC)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C23H29NO4/c1-4-5-13-28-23(25)22-21-18(14-19(26-2)15-20(21)27-3)11-12-24(22)16-17-9-7-6-8-10-17/h6-10,14-15,22H,4-5,11-13,16H2,1-3H3/t22-/m1/s1 |
| InChIKey | XLZQLNYDGYJTCV-JOCHJYFZSA-N |
| XLogP | 4.15 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|