C25H29NO5 — CID 54391802
butyl 4-(4-methoxyphenyl)-1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate (PubChem CID 54391802) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is butyl 4-(4-methoxyphenyl)-1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate.
| Compound Name | butyl 4-(4-methoxyphenyl)-1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 54391802 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | butyl 4-(4-methoxyphenyl)-1-(2-oxo-2-phenylacetyl)piperidine-2-carboxylate |
| SMILES | CCCCOC(=O)C1CC(c2ccc(OC)cc2)CCN1C(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H29NO5/c1-3-4-16-31-25(29)22-17-20(18-10-12-21(30-2)13-11-18)14-15-26(22)24(28)23(27)19-8-6-5-7-9-19/h5-13,20,22H,3-4,14-17H2,1-2H3 |
| InChIKey | VHDRFSVTOGYOEK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|