C16H22FNO2 — CID 71204712
butyl (2R,4S)-1-benzyl-4-fluoropyrrolidine-2-carboxylate (PubChem CID 71204712) has the molecular formula C16H22FNO2 and a molecular weight of 279.35 g/mol. Its IUPAC name is butyl (2R,4S)-1-benzyl-4-fluoropyrrolidine-2-carboxylate.
| Compound Name | butyl (2R,4S)-1-benzyl-4-fluoropyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 71204712 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | butyl (2R,4S)-1-benzyl-4-fluoropyrrolidine-2-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1C[C@H](F)CN1Cc1ccccc1 |
| InChI | InChI=1S/C16H22FNO2/c1-2-3-9-20-16(19)15-10-14(17)12-18(15)11-13-7-5-4-6-8-13/h4-8,14-15H,2-3,9-12H2,1H3/t14-,15+/m0/s1 |
| InChIKey | INNMHZVTCUPVKW-LSDHHAIUSA-N |
| XLogP | 2.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|