C18H27NO2 — CID 23248596
ethyl (2S,4S)-1-benzyl-4-butylpyrrolidine-2-carboxylate (PubChem CID 23248596) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is ethyl (2S,4S)-1-benzyl-4-butylpyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,4S)-1-benzyl-4-butylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 23248596 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | ethyl (2S,4S)-1-benzyl-4-butylpyrrolidine-2-carboxylate |
| SMILES | CCCC[C@H]1C[C@@H](C(=O)OCC)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H27NO2/c1-3-5-9-16-12-17(18(20)21-4-2)19(14-16)13-15-10-7-6-8-11-15/h6-8,10-11,16-17H,3-5,9,12-14H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | AKGHTKJOURLTMA-IRXDYDNUSA-N |
| XLogP | 3.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |