C24H30N2O3 — CID 101052917
butyl (3S,6R,7aS)-1-benzyl-6-methyl-3-phenyl-2,3,7,7a-tetrahydroimidazo[1,2-b][1,2]oxazole-6-carboxylate (PubChem CID 101052917) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is butyl (3S,6R,7aS)-1-benzyl-6-methyl-3-phenyl-2,3,7,7a-tetrahydroimidazo[1,2-b][1,2]oxazole-6-carboxylate.
| Compound Name | butyl (3S,6R,7aS)-1-benzyl-6-methyl-3-phenyl-2,3,7,7a-tetrahydroimidazo[1,2-b][1,2]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 101052917 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | butyl (3S,6R,7aS)-1-benzyl-6-methyl-3-phenyl-2,3,7,7a-tetrahydroimidazo[1,2-b][1,2]oxazole-6-carboxylate |
| SMILES | CCCCOC(=O)[C@@]1(C)C[C@H]2N(Cc3ccccc3)C[C@H](c3ccccc3)N2O1 |
| InChI | InChI=1S/C24H30N2O3/c1-3-4-15-28-23(27)24(2)16-22-25(17-19-11-7-5-8-12-19)18-21(26(22)29-24)20-13-9-6-10-14-20/h5-14,21-22H,3-4,15-18H2,1-2H3/t21-,22+,24-/m1/s1 |
| InChIKey | OXCCLFDFMHYFFE-AOHZBQACSA-N |
| XLogP | 4.31 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|