C21H33NO4 — CID 90059635
2-[(2R,3R,4R)-1-benzyl-3,4-dibutoxypyrrolidin-2-yl]acetic acid (PubChem CID 90059635) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-[(2R,3R,4R)-1-benzyl-3,4-dibutoxypyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[(2R,3R,4R)-1-benzyl-3,4-dibutoxypyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 90059635 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 2-[(2R,3R,4R)-1-benzyl-3,4-dibutoxypyrrolidin-2-yl]acetic acid |
| SMILES | CCCCO[C@@H]1[C@@H](CC(=O)O)N(Cc2ccccc2)C[C@H]1OCCCC |
| InChI | InChI=1S/C21H33NO4/c1-3-5-12-25-19-16-22(15-17-10-8-7-9-11-17)18(14-20(23)24)21(19)26-13-6-4-2/h7-11,18-19,21H,3-6,12-16H2,1-2H3,(H,23,24)/t18-,19-,21-/m1/s1 |
| InChIKey | PVHDOFVJAAEWFG-SFHLNBCPSA-N |
| XLogP | 3.72 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|