C17H26N2O6 — CID 11360195
2-[(2R,3R,4R)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidin-2-yl]-N-hydroxyacetamide (PubChem CID 11360195) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is 2-[(2R,3R,4R)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidin-2-yl]-N-hydroxyacetamide.
| Compound Name | 2-[(2R,3R,4R)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidin-2-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 11360195 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-[(2R,3R,4R)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidin-2-yl]-N-hydroxyacetamide |
| SMILES | COCO[C@@H]1[C@@H](CC(=O)NO)N(Cc2ccccc2)C[C@H]1OCOC |
| InChI | InChI=1S/C17H26N2O6/c1-22-11-24-15-10-19(9-13-6-4-3-5-7-13)14(8-16(20)18-21)17(15)25-12-23-2/h3-7,14-15,17,21H,8-12H2,1-2H3,(H,18,20)/t14-,15-,17-/m1/s1 |
| InChIKey | SHHAELWOLMBBGQ-BFYDXBDKSA-N |
| XLogP | 0.74 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|