C16H23FN2O3 — CID 118287479
N-[(3S,4S,5R)-1-benzyl-4-fluoro-5-(methoxymethoxy)piperidin-3-yl]acetamide (PubChem CID 118287479) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is N-[(3S,4S,5R)-1-benzyl-4-fluoro-5-(methoxymethoxy)piperidin-3-yl]acetamide.
| Compound Name | N-[(3S,4S,5R)-1-benzyl-4-fluoro-5-(methoxymethoxy)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 118287479 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-[(3S,4S,5R)-1-benzyl-4-fluoro-5-(methoxymethoxy)piperidin-3-yl]acetamide |
| SMILES | COCO[C@@H]1CN(Cc2ccccc2)C[C@H](NC(C)=O)[C@@H]1F |
| InChI | InChI=1S/C16H23FN2O3/c1-12(20)18-14-9-19(8-13-6-4-3-5-7-13)10-15(16(14)17)22-11-21-2/h3-7,14-16H,8-11H2,1-2H3,(H,18,20)/t14-,15+,16-/m0/s1 |
| InChIKey | NQFPZHUYEFNOIE-XHSDSOJGSA-N |
| XLogP | 1.33 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|